C14H21NO6Si — CID 167720163
2-[4-[tert-butyl(dimethyl)silyl]oxy-3-nitrophenyl]-2-hydroxyacetic acid (PubChem CID 167720163) has the molecular formula C14H21NO6Si and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-nitrophenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-nitrophenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 167720163 |
| Molecular Formula | C14H21NO6Si |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-nitrophenyl]-2-hydroxyacetic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C(O)C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21NO6Si/c1-14(2,3)22(4,5)21-11-7-6-9(12(16)13(17)18)8-10(11)15(19)20/h6-8,12,16H,1-5H3,(H,17,18) |
| InChIKey | CFKNMFLAXNOQRB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|