C11H15NO6Si — CID 167740793
2-hydroxy-2-(3-nitro-4-trimethylsilyloxyphenyl)acetic acid (PubChem CID 167740793) has the molecular formula C11H15NO6Si and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-hydroxy-2-(3-nitro-4-trimethylsilyloxyphenyl)acetic acid.
| Compound Name | 2-hydroxy-2-(3-nitro-4-trimethylsilyloxyphenyl)acetic acid |
|---|---|
| PubChem CID | 167740793 |
| Molecular Formula | C11H15NO6Si |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-hydroxy-2-(3-nitro-4-trimethylsilyloxyphenyl)acetic acid |
| SMILES | C[Si](C)(C)Oc1ccc(C(O)C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15NO6Si/c1-19(2,3)18-9-5-4-7(10(13)11(14)15)6-8(9)12(16)17/h4-6,10,13H,1-3H3,(H,14,15) |
| InChIKey | GHFQTIICDRGMAH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|