C12H12F3NO4 — CID 118238787
1,1,3-trifluoro-3-(3-nitro-4-propan-2-yloxyphenyl)propan-2-one (PubChem CID 118238787) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is 1,1,3-trifluoro-3-(3-nitro-4-propan-2-yloxyphenyl)propan-2-one.
| Compound Name | 1,1,3-trifluoro-3-(3-nitro-4-propan-2-yloxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 118238787 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1,1,3-trifluoro-3-(3-nitro-4-propan-2-yloxyphenyl)propan-2-one |
| SMILES | CC(C)Oc1ccc(C(F)C(=O)C(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12F3NO4/c1-6(2)20-9-4-3-7(5-8(9)16(18)19)10(13)11(17)12(14)15/h3-6,10,12H,1-2H3 |
| InChIKey | WHZZZVWZPVWTLK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|