C11H13F3N2O5S — CID 90101060
3-nitro-4-propan-2-yloxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 90101060) has the molecular formula C11H13F3N2O5S and a molecular weight of 342.30 g/mol. Its IUPAC name is 3-nitro-4-propan-2-yloxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 3-nitro-4-propan-2-yloxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90101060 |
| Molecular Formula | C11H13F3N2O5S |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 3-nitro-4-propan-2-yloxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)NCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13F3N2O5S/c1-7(2)21-10-4-3-8(5-9(10)16(17)18)22(19,20)15-6-11(12,13)14/h3-5,7,15H,6H2,1-2H3 |
| InChIKey | NKIILZSQYSNILN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|