C20H31FN2O7Si — CID 10623752
(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluoro-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 10623752) has the molecular formula C20H31FN2O7Si and a molecular weight of 458.56 g/mol. Its IUPAC name is (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluoro-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluoro-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 10623752 |
| Molecular Formula | C20H31FN2O7Si |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluoro-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)O)[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H31FN2O7Si/c1-19(2,3)29-18(26)22-15(17(24)25)16(30-31(7,8)20(4,5)6)12-9-10-13(21)14(11-12)23(27)28/h9-11,15-16H,1-8H3,(H,22,26)(H,24,25)/t15-,16-/m1/s1 |
| InChIKey | UXISEFRFNVFFIK-HZPDHXFCSA-N |
| XLogP | 4.77 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|