C15H21FN2O6 — CID 171885289
tert-butyl N-[4-(4-fluoro-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171885289) has the molecular formula C15H21FN2O6 and a molecular weight of 344.34 g/mol. Its IUPAC name is tert-butyl N-[4-(4-fluoro-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-fluoro-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171885289 |
| Molecular Formula | C15H21FN2O6 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | tert-butyl N-[4-(4-fluoro-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H21FN2O6/c1-15(2,3)24-14(21)17-7-6-12(19)13(20)9-4-5-10(16)11(8-9)18(22)23/h4-5,8,12-13,19-20H,6-7H2,1-3H3,(H,17,21) |
| InChIKey | WULIOEDRFGDDBE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|