C14H19FN2O6 — CID 170832555
tert-butyl N-[3-(3-fluoro-4-nitrophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170832555) has the molecular formula C14H19FN2O6 and a molecular weight of 330.31 g/mol. Its IUPAC name is tert-butyl N-[3-(3-fluoro-4-nitrophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-fluoro-4-nitrophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170832555 |
| Molecular Formula | C14H19FN2O6 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | tert-butyl N-[3-(3-fluoro-4-nitrophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C14H19FN2O6/c1-14(2,3)23-13(20)16-7-11(18)12(19)8-4-5-10(17(21)22)9(15)6-8/h4-6,11-12,18-19H,7H2,1-3H3,(H,16,20) |
| InChIKey | ODHSKEWMNIDBJB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|