C17H24N2O8 — CID 170833121
methyl 5-[1,2-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-methyl-3-nitrobenzoate (PubChem CID 170833121) has the molecular formula C17H24N2O8 and a molecular weight of 384.39 g/mol. Its IUPAC name is methyl 5-[1,2-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-methyl-3-nitrobenzoate.
| Compound Name | methyl 5-[1,2-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 170833121 |
| Molecular Formula | C17H24N2O8 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | methyl 5-[1,2-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-methyl-3-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)CNC(=O)OC(C)(C)C)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C17H24N2O8/c1-9-11(15(22)26-5)6-10(7-12(9)19(24)25)14(21)13(20)8-18-16(23)27-17(2,3)4/h6-7,13-14,20-21H,8H2,1-5H3,(H,18,23) |
| InChIKey | MKKCNXAKWKJXGF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|