C9H6BrF3O4 — CID 170997689
2-[3-bromo-4-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid (PubChem CID 170997689) has the molecular formula C9H6BrF3O4 and a molecular weight of 315.04 g/mol. Its IUPAC name is 2-[3-bromo-4-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[3-bromo-4-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 170997689 |
| Molecular Formula | C9H6BrF3O4 |
| Molecular Weight | 315.04 g/mol |
| Exact Mass | 313.94 |
| IUPAC Name | 2-[3-bromo-4-(trifluoromethoxy)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C9H6BrF3O4/c10-5-3-4(7(14)8(15)16)1-2-6(5)17-9(11,12)13/h1-3,7,14H,(H,15,16) |
| InChIKey | LKSDAMVQXSIUSR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.04 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |