C24H10F18N2O2 — CID 18691783
3-[3-[3-amino-2,6-bis(trifluoromethyl)phenoxy]-2,4-bis(trifluoromethyl)phenoxy]-2,4-bis(trifluoromethyl)aniline (PubChem CID 18691783) has the molecular formula C24H10F18N2O2 and a molecular weight of 700.32 g/mol. Its IUPAC name is 3-[3-[3-amino-2,6-bis(trifluoromethyl)phenoxy]-2,4-bis(trifluoromethyl)phenoxy]-2,4-bis(trifluoromethyl)aniline.
| Compound Name | 3-[3-[3-amino-2,6-bis(trifluoromethyl)phenoxy]-2,4-bis(trifluoromethyl)phenoxy]-2,4-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 18691783 |
| Molecular Formula | C24H10F18N2O2 |
| Molecular Weight | 700.32 g/mol |
| Exact Mass | 700.05 |
| IUPAC Name | 3-[3-[3-amino-2,6-bis(trifluoromethyl)phenoxy]-2,4-bis(trifluoromethyl)phenoxy]-2,4-bis(trifluoromethyl)aniline |
| SMILES | Nc1ccc(C(F)(F)F)c(Oc2ccc(C(F)(F)F)c(Oc3c(C(F)(F)F)ccc(N)c3C(F)(F)F)c2C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C24H10F18N2O2/c25-19(26,27)7-1-4-10(43)13(22(34,35)36)16(7)45-12-6-3-9(21(31,32)33)18(15(12)24(40,41)42)46-17-8(20(28,29)30)2-5-11(44)14(17)23(37,38)39/h1-6H,43-44H2 |
| InChIKey | NWXMSZNXKSPTHC-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.32 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|