C19H12F6N2O2 — CID 18692248
3-[3-(5-amino-2-fluorophenoxy)-2-fluoro-4-(trifluoromethyl)phenoxy]-4-fluoroaniline (PubChem CID 18692248) has the molecular formula C19H12F6N2O2 and a molecular weight of 414.31 g/mol. Its IUPAC name is 3-[3-(5-amino-2-fluorophenoxy)-2-fluoro-4-(trifluoromethyl)phenoxy]-4-fluoroaniline.
| Compound Name | 3-[3-(5-amino-2-fluorophenoxy)-2-fluoro-4-(trifluoromethyl)phenoxy]-4-fluoroaniline |
|---|---|
| PubChem CID | 18692248 |
| Molecular Formula | C19H12F6N2O2 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 3-[3-(5-amino-2-fluorophenoxy)-2-fluoro-4-(trifluoromethyl)phenoxy]-4-fluoroaniline |
| SMILES | Nc1ccc(F)c(Oc2ccc(C(F)(F)F)c(Oc3cc(N)ccc3F)c2F)c1 |
| InChI | InChI=1S/C19H12F6N2O2/c20-12-4-1-9(26)7-15(12)28-14-6-3-11(19(23,24)25)18(17(14)22)29-16-8-10(27)2-5-13(16)21/h1-8H,26-27H2 |
| InChIKey | OYAGKYDTKTVKGS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|