C20H10F10N2O2 — CID 18691777
3-[3-(3-amino-2,4-difluorophenoxy)-2,4-bis(trifluoromethyl)phenoxy]-2,6-difluoroaniline (PubChem CID 18691777) has the molecular formula C20H10F10N2O2 and a molecular weight of 500.29 g/mol. Its IUPAC name is 3-[3-(3-amino-2,4-difluorophenoxy)-2,4-bis(trifluoromethyl)phenoxy]-2,6-difluoroaniline.
| Compound Name | 3-[3-(3-amino-2,4-difluorophenoxy)-2,4-bis(trifluoromethyl)phenoxy]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 18691777 |
| Molecular Formula | C20H10F10N2O2 |
| Molecular Weight | 500.29 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 3-[3-(3-amino-2,4-difluorophenoxy)-2,4-bis(trifluoromethyl)phenoxy]-2,6-difluoroaniline |
| SMILES | Nc1c(F)ccc(Oc2ccc(C(F)(F)F)c(Oc3ccc(F)c(N)c3F)c2C(F)(F)F)c1F |
| InChI | InChI=1S/C20H10F10N2O2/c21-8-2-5-11(14(23)16(8)31)33-10-4-1-7(19(25,26)27)18(13(10)20(28,29)30)34-12-6-3-9(22)17(32)15(12)24/h1-6H,31-32H2 |
| InChIKey | NOLMQKYUGFMEJI-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.29 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|