C21H7F15N2O2 — CID 18691877
3-[3-[3-amino-2,5,6-trifluoro-4-(trifluoromethyl)phenoxy]-4-(trifluoromethyl)phenoxy]-2,4,5-trifluoro-6-(trifluoromethyl)aniline (PubChem CID 18691877) has the molecular formula C21H7F15N2O2 and a molecular weight of 604.27 g/mol. Its IUPAC name is 3-[3-[3-amino-2,5,6-trifluoro-4-(trifluoromethyl)phenoxy]-4-(trifluoromethyl)phenoxy]-2,4,5-trifluoro-6-(trifluoromethyl)aniline.
| Compound Name | 3-[3-[3-amino-2,5,6-trifluoro-4-(trifluoromethyl)phenoxy]-4-(trifluoromethyl)phenoxy]-2,4,5-trifluoro-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 18691877 |
| Molecular Formula | C21H7F15N2O2 |
| Molecular Weight | 604.27 g/mol |
| Exact Mass | 604.03 |
| IUPAC Name | 3-[3-[3-amino-2,5,6-trifluoro-4-(trifluoromethyl)phenoxy]-4-(trifluoromethyl)phenoxy]-2,4,5-trifluoro-6-(trifluoromethyl)aniline |
| SMILES | Nc1c(F)c(Oc2ccc(C(F)(F)F)c(Oc3c(F)c(N)c(C(F)(F)F)c(F)c3F)c2)c(F)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C21H7F15N2O2/c22-9-7(20(31,32)33)15(37)13(26)17(11(9)24)39-4-1-2-5(19(28,29)30)6(3-4)40-18-12(25)10(23)8(21(34,35)36)16(38)14(18)27/h1-3H,37-38H2 |
| InChIKey | RTKIUHAQYYAOKX-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.27 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|