C22H12F12N2O2 — CID 18691823
5-[3-[3-amino-4-(trifluoromethyl)phenoxy]-4,5-bis(trifluoromethyl)phenoxy]-2-(trifluoromethyl)aniline (PubChem CID 18691823) has the molecular formula C22H12F12N2O2 and a molecular weight of 564.33 g/mol. Its IUPAC name is 5-[3-[3-amino-4-(trifluoromethyl)phenoxy]-4,5-bis(trifluoromethyl)phenoxy]-2-(trifluoromethyl)aniline.
| Compound Name | 5-[3-[3-amino-4-(trifluoromethyl)phenoxy]-4,5-bis(trifluoromethyl)phenoxy]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 18691823 |
| Molecular Formula | C22H12F12N2O2 |
| Molecular Weight | 564.33 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 5-[3-[3-amino-4-(trifluoromethyl)phenoxy]-4,5-bis(trifluoromethyl)phenoxy]-2-(trifluoromethyl)aniline |
| SMILES | Nc1cc(Oc2cc(Oc3ccc(C(F)(F)F)c(N)c3)c(C(F)(F)F)c(C(F)(F)F)c2)ccc1C(F)(F)F |
| InChI | InChI=1S/C22H12F12N2O2/c23-19(24,25)12-3-1-9(6-15(12)35)37-11-5-14(21(29,30)31)18(22(32,33)34)17(8-11)38-10-2-4-13(16(36)7-10)20(26,27)28/h1-8H,35-36H2 |
| InChIKey | XZXKOBDFYXLNKE-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.33 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|