C20H10F10N2O2 — CID 18692418
5-[3-(3-amino-4-fluorophenoxy)-2,5-difluoro-4,6-bis(trifluoromethyl)phenoxy]-2-fluoroaniline (PubChem CID 18692418) has the molecular formula C20H10F10N2O2 and a molecular weight of 500.29 g/mol. Its IUPAC name is 5-[3-(3-amino-4-fluorophenoxy)-2,5-difluoro-4,6-bis(trifluoromethyl)phenoxy]-2-fluoroaniline.
| Compound Name | 5-[3-(3-amino-4-fluorophenoxy)-2,5-difluoro-4,6-bis(trifluoromethyl)phenoxy]-2-fluoroaniline |
|---|---|
| PubChem CID | 18692418 |
| Molecular Formula | C20H10F10N2O2 |
| Molecular Weight | 500.29 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 5-[3-(3-amino-4-fluorophenoxy)-2,5-difluoro-4,6-bis(trifluoromethyl)phenoxy]-2-fluoroaniline |
| SMILES | Nc1cc(Oc2c(F)c(Oc3ccc(F)c(N)c3)c(C(F)(F)F)c(F)c2C(F)(F)F)ccc1F |
| InChI | InChI=1S/C20H10F10N2O2/c21-9-3-1-7(5-11(9)31)33-17-13(19(25,26)27)15(23)14(20(28,29)30)18(16(17)24)34-8-2-4-10(22)12(32)6-8/h1-6H,31-32H2 |
| InChIKey | KOQZVYOJONGXFP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.29 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|