C26H20F6N4O3 — CID 141224962
2-[4-[4-[2,6-diamino-4-(trifluoromethyl)phenoxy]phenoxy]phenoxy]-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 141224962) has the molecular formula C26H20F6N4O3 and a molecular weight of 550.46 g/mol. Its IUPAC name is 2-[4-[4-[2,6-diamino-4-(trifluoromethyl)phenoxy]phenoxy]phenoxy]-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 2-[4-[4-[2,6-diamino-4-(trifluoromethyl)phenoxy]phenoxy]phenoxy]-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 141224962 |
| Molecular Formula | C26H20F6N4O3 |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 2-[4-[4-[2,6-diamino-4-(trifluoromethyl)phenoxy]phenoxy]phenoxy]-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | Nc1cc(C(F)(F)F)cc(N)c1Oc1ccc(Oc2ccc(Oc3c(N)cc(C(F)(F)F)cc3N)cc2)cc1 |
| InChI | InChI=1S/C26H20F6N4O3/c27-25(28,29)13-9-19(33)23(20(34)10-13)38-17-5-1-15(2-6-17)37-16-3-7-18(8-4-16)39-24-21(35)11-14(12-22(24)36)26(30,31)32/h1-12H,33-36H2 |
| InChIKey | IBQJEKFXXGWQEI-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|