C27H18F8N2O2 — CID 19910092
4-[4-[2-[4-(4-amino-3-fluorophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-2-fluoroaniline (PubChem CID 19910092) has the molecular formula C27H18F8N2O2 and a molecular weight of 554.44 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-amino-3-fluorophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-2-fluoroaniline.
| Compound Name | 4-[4-[2-[4-(4-amino-3-fluorophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-2-fluoroaniline |
|---|---|
| PubChem CID | 19910092 |
| Molecular Formula | C27H18F8N2O2 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 4-[4-[2-[4-(4-amino-3-fluorophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-2-fluoroaniline |
| SMILES | Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)c(F)c4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C27H18F8N2O2/c28-21-13-19(9-11-23(21)36)38-17-5-1-15(2-6-17)25(26(30,31)32,27(33,34)35)16-3-7-18(8-4-16)39-20-10-12-24(37)22(29)14-20/h1-14H,36-37H2 |
| InChIKey | SDSZNFOUDZMSFN-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|