C8H6FN3OS — CID 65273788
2-fluoro-4-(1,2,4-thiadiazol-5-yloxy)aniline (PubChem CID 65273788) has the molecular formula C8H6FN3OS and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-fluoro-4-(1,2,4-thiadiazol-5-yloxy)aniline.
| Compound Name | 2-fluoro-4-(1,2,4-thiadiazol-5-yloxy)aniline |
|---|---|
| PubChem CID | 65273788 |
| Molecular Formula | C8H6FN3OS |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 2-fluoro-4-(1,2,4-thiadiazol-5-yloxy)aniline |
| SMILES | Nc1ccc(Oc2ncns2)cc1F |
| InChI | InChI=1S/C8H6FN3OS/c9-6-3-5(1-2-7(6)10)13-8-11-4-12-14-8/h1-4H,10H2 |
| InChIKey | YRWQULNKMHOPGE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|