C11H8N4OS — CID 116525595
5-(1,2,4-thiadiazol-5-yloxy)quinolin-8-amine (PubChem CID 116525595) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 5-(1,2,4-thiadiazol-5-yloxy)quinolin-8-amine.
| Compound Name | 5-(1,2,4-thiadiazol-5-yloxy)quinolin-8-amine |
|---|---|
| PubChem CID | 116525595 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 5-(1,2,4-thiadiazol-5-yloxy)quinolin-8-amine |
| SMILES | Nc1ccc(Oc2ncns2)c2cccnc12 |
| InChI | InChI=1S/C11H8N4OS/c12-8-3-4-9(16-11-14-6-15-17-11)7-2-1-5-13-10(7)8/h1-6H,12H2 |
| InChIKey | STRCLCLRYAFHQA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|