C14H11FN4O2S — CID 157047054
2-fluoro-4-[[4-(2-methoxypyrimidin-5-yl)-1,3-thiazol-2-yl]oxy]aniline (PubChem CID 157047054) has the molecular formula C14H11FN4O2S and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-fluoro-4-[[4-(2-methoxypyrimidin-5-yl)-1,3-thiazol-2-yl]oxy]aniline.
| Compound Name | 2-fluoro-4-[[4-(2-methoxypyrimidin-5-yl)-1,3-thiazol-2-yl]oxy]aniline |
|---|---|
| PubChem CID | 157047054 |
| Molecular Formula | C14H11FN4O2S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-fluoro-4-[[4-(2-methoxypyrimidin-5-yl)-1,3-thiazol-2-yl]oxy]aniline |
| SMILES | COc1ncc(-c2csc(Oc3ccc(N)c(F)c3)n2)cn1 |
| InChI | InChI=1S/C14H11FN4O2S/c1-20-13-17-5-8(6-18-13)12-7-22-14(19-12)21-9-2-3-11(16)10(15)4-9/h2-7H,16H2,1H3 |
| InChIKey | JZEZOAVVIMJNNU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|