C13H15FN4O — CID 105362901
4-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-2-fluoroaniline (PubChem CID 105362901) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is 4-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-2-fluoroaniline.
| Compound Name | 4-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-2-fluoroaniline |
|---|---|
| PubChem CID | 105362901 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-2-fluoroaniline |
| SMILES | CCc1nnc(Oc2ccc(N)c(F)c2)nc1CC |
| InChI | InChI=1S/C13H15FN4O/c1-3-11-12(4-2)17-18-13(16-11)19-8-5-6-10(15)9(14)7-8/h5-7H,3-4,15H2,1-2H3 |
| InChIKey | SSJFLYBBQIMFHW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|