C13H14IN3O — CID 105362314
5,6-diethyl-3-(3-iodophenoxy)-1,2,4-triazine (PubChem CID 105362314) has the molecular formula C13H14IN3O and a molecular weight of 355.18 g/mol. Its IUPAC name is 5,6-diethyl-3-(3-iodophenoxy)-1,2,4-triazine.
| Compound Name | 5,6-diethyl-3-(3-iodophenoxy)-1,2,4-triazine |
|---|---|
| PubChem CID | 105362314 |
| Molecular Formula | C13H14IN3O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 5,6-diethyl-3-(3-iodophenoxy)-1,2,4-triazine |
| SMILES | CCc1nnc(Oc2cccc(I)c2)nc1CC |
| InChI | InChI=1S/C13H14IN3O/c1-3-11-12(4-2)16-17-13(15-11)18-10-7-5-6-9(14)8-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | OAFMVRSPRAWMPT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|