C11H12IN5O — CID 80881203
6-(3-iodophenoxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80881203) has the molecular formula C11H12IN5O and a molecular weight of 357.16 g/mol. Its IUPAC name is 6-(3-iodophenoxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3-iodophenoxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80881203 |
| Molecular Formula | C11H12IN5O |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 6-(3-iodophenoxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(Oc2cccc(I)c2)n1 |
| InChI | InChI=1S/C11H12IN5O/c1-17(2)10-14-9(13)15-11(16-10)18-8-5-3-4-7(12)6-8/h3-6H,1-2H3,(H2,13,14,15,16) |
| InChIKey | XRYZOXCZELVAPA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|