C11H12N6O3 — CID 80870950
2-N,2-N-dimethyl-6-(3-nitrophenoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 80870950) has the molecular formula C11H12N6O3 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-(3-nitrophenoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-(3-nitrophenoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80870950 |
| Molecular Formula | C11H12N6O3 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-N,2-N-dimethyl-6-(3-nitrophenoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(Oc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H12N6O3/c1-16(2)10-13-9(12)14-11(15-10)20-8-5-3-4-7(6-8)17(18)19/h3-6H,1-2H3,(H2,12,13,14,15) |
| InChIKey | ISOQROYQRXIEQS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|