C11H11ClN6O3 — CID 80880404
6-(2-chloro-5-nitrophenoxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80880404) has the molecular formula C11H11ClN6O3 and a molecular weight of 310.70 g/mol. Its IUPAC name is 6-(2-chloro-5-nitrophenoxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-5-nitrophenoxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80880404 |
| Molecular Formula | C11H11ClN6O3 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 6-(2-chloro-5-nitrophenoxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(Oc2cc([N+](=O)[O-])ccc2Cl)n1 |
| InChI | InChI=1S/C11H11ClN6O3/c1-17(2)10-14-9(13)15-11(16-10)21-8-5-6(18(19)20)3-4-7(8)12/h3-5H,1-2H3,(H2,13,14,15,16) |
| InChIKey | KGCDIIWECZADTP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|