C11H9ClIN3O2 — CID 62859033
2-chloro-4-ethoxy-6-(3-iodophenoxy)-1,3,5-triazine (PubChem CID 62859033) has the molecular formula C11H9ClIN3O2 and a molecular weight of 377.57 g/mol. Its IUPAC name is 2-chloro-4-ethoxy-6-(3-iodophenoxy)-1,3,5-triazine.
| Compound Name | 2-chloro-4-ethoxy-6-(3-iodophenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 62859033 |
| Molecular Formula | C11H9ClIN3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | 2-chloro-4-ethoxy-6-(3-iodophenoxy)-1,3,5-triazine |
| SMILES | CCOc1nc(Cl)nc(Oc2cccc(I)c2)n1 |
| InChI | InChI=1S/C11H9ClIN3O2/c1-2-17-10-14-9(12)15-11(16-10)18-8-5-3-4-7(13)6-8/h3-6H,2H2,1H3 |
| InChIKey | WUZGQKNGOIMVHX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|