C15H18ClN3O2 — CID 115492564
2-(4-butylphenoxy)-4-chloro-6-ethoxy-1,3,5-triazine (PubChem CID 115492564) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 2-(4-butylphenoxy)-4-chloro-6-ethoxy-1,3,5-triazine.
| Compound Name | 2-(4-butylphenoxy)-4-chloro-6-ethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 115492564 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-(4-butylphenoxy)-4-chloro-6-ethoxy-1,3,5-triazine |
| SMILES | CCCCc1ccc(Oc2nc(Cl)nc(OCC)n2)cc1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-3-5-6-11-7-9-12(10-8-11)21-15-18-13(16)17-14(19-15)20-4-2/h7-10H,3-6H2,1-2H3 |
| InChIKey | GNPIQGBGKYFUNE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |