C15H19ClN4O — CID 115492551
4-(4-butylphenoxy)-6-chloro-N,N-dimethyl-1,3,5-triazin-2-amine (PubChem CID 115492551) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 4-(4-butylphenoxy)-6-chloro-N,N-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-butylphenoxy)-6-chloro-N,N-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115492551 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-(4-butylphenoxy)-6-chloro-N,N-dimethyl-1,3,5-triazin-2-amine |
| SMILES | CCCCc1ccc(Oc2nc(Cl)nc(N(C)C)n2)cc1 |
| InChI | InChI=1S/C15H19ClN4O/c1-4-5-6-11-7-9-12(10-8-11)21-15-18-13(16)17-14(19-15)20(2)3/h7-10H,4-6H2,1-3H3 |
| InChIKey | BNSBAKZFNUMPDX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |