C13H13Cl2N3O — CID 55124372
2-(3-tert-butylphenoxy)-4,6-dichloro-1,3,5-triazine (PubChem CID 55124372) has the molecular formula C13H13Cl2N3O and a molecular weight of 298.17 g/mol. Its IUPAC name is 2-(3-tert-butylphenoxy)-4,6-dichloro-1,3,5-triazine.
| Compound Name | 2-(3-tert-butylphenoxy)-4,6-dichloro-1,3,5-triazine |
|---|---|
| PubChem CID | 55124372 |
| Molecular Formula | C13H13Cl2N3O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-(3-tert-butylphenoxy)-4,6-dichloro-1,3,5-triazine |
| SMILES | CC(C)(C)c1cccc(Oc2nc(Cl)nc(Cl)n2)c1 |
| InChI | InChI=1S/C13H13Cl2N3O/c1-13(2,3)8-5-4-6-9(7-8)19-12-17-10(14)16-11(15)18-12/h4-7H,1-3H3 |
| InChIKey | RHSZZMKGXSEQTE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |