C13H15ClN4O — CID 105362891
3-chloro-4-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]aniline (PubChem CID 105362891) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is 3-chloro-4-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]aniline.
| Compound Name | 3-chloro-4-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]aniline |
|---|---|
| PubChem CID | 105362891 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-chloro-4-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]aniline |
| SMILES | CCc1nnc(Oc2ccc(N)cc2Cl)nc1CC |
| InChI | InChI=1S/C13H15ClN4O/c1-3-10-11(4-2)17-18-13(16-10)19-12-6-5-8(15)7-9(12)14/h5-7H,3-4,15H2,1-2H3 |
| InChIKey | XQOOWXDIEVCNIV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|