C14H14FN3O3 — CID 105363223
2-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-5-fluorobenzoic acid (PubChem CID 105363223) has the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-5-fluorobenzoic acid.
| Compound Name | 2-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 105363223 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-5-fluorobenzoic acid |
| SMILES | CCc1nnc(Oc2ccc(F)cc2C(=O)O)nc1CC |
| InChI | InChI=1S/C14H14FN3O3/c1-3-10-11(4-2)17-18-14(16-10)21-12-6-5-8(15)7-9(12)13(19)20/h5-7H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | ICLIXAVKNVIBJV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |