2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid

C12H11FN2O4 — CID 115297819

IUPAC2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid
SMILESCCc1nc(COc2ccc(F)cc2C(=O)O)no1
InChIInChI=1S/C12H11FN2O4/c1-2-11-14-10(15-19-11)6-18-9-4-3-7(13)5-8(9)12(16)17/h3-5H,2,6H2,1H3,(H,16,17)
InChIKeyVOWRZEODLJPTRU-UHFFFAOYSA-N
MW266.23 g/mol
LogP2.05
Rot. Bonds5

About 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid

2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid (PubChem CID 115297819) has the molecular formula C12H11FN2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid.

Molecular Properties

Compound Name2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid
PubChem CID115297819
Molecular FormulaC12H11FN2O4
Molecular Weight266.23 g/mol
Exact Mass266.07
IUPAC Name2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid
SMILESCCc1nc(COc2ccc(F)cc2C(=O)O)no1
InChIInChI=1S/C12H11FN2O4/c1-2-11-14-10(15-19-11)6-18-9-4-3-7(13)5-8(9)12(16)17/h3-5H,2,6H2,1H3,(H,16,17)
InChIKeyVOWRZEODLJPTRU-UHFFFAOYSA-N
XLogP2.05
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.23
LogP ≤ 52.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid?
The IUPAC name of 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid (CID 115297819) is 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid.
What is the SMILES notation for 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid?
The canonical SMILES for 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid is CCc1nc(COc2ccc(F)cc2C(=O)O)no1.
What is the InChIKey of 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid?
The InChIKey is VOWRZEODLJPTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2O4/c1-2-11-14-10(15-19-11)6-18-9-4-3-7(13)5-8(9)12(16)17/h3-5H,2,6H2,1H3,(H,16,17).
What are the key properties of 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid?
2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid has a molecular weight of 266.23 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid is sourced from PubChem (CID 115297819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).