C12H11FN2O4 — CID 115297819
2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid (PubChem CID 115297819) has the molecular formula C12H11FN2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid.
| Compound Name | 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 115297819 |
| Molecular Formula | C12H11FN2O4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-5-fluorobenzoic acid |
| SMILES | CCc1nc(COc2ccc(F)cc2C(=O)O)no1 |
| InChI | InChI=1S/C12H11FN2O4/c1-2-11-14-10(15-19-11)6-18-9-4-3-7(13)5-8(9)12(16)17/h3-5H,2,6H2,1H3,(H,16,17) |
| InChIKey | VOWRZEODLJPTRU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |