C14H15IN2O4 — CID 82991397
2-[(3-butyl-1,2,4-oxadiazol-5-yl)methoxy]-5-iodobenzoic acid (PubChem CID 82991397) has the molecular formula C14H15IN2O4 and a molecular weight of 402.19 g/mol. Its IUPAC name is 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methoxy]-5-iodobenzoic acid.
| Compound Name | 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methoxy]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 82991397 |
| Molecular Formula | C14H15IN2O4 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methoxy]-5-iodobenzoic acid |
| SMILES | CCCCc1noc(COc2ccc(I)cc2C(=O)O)n1 |
| InChI | InChI=1S/C14H15IN2O4/c1-2-3-4-12-16-13(21-17-12)8-20-11-6-5-9(15)7-10(11)14(18)19/h5-7H,2-4,8H2,1H3,(H,18,19) |
| InChIKey | ZKLBJJKJLDPBTJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|