C13H13FN2O4 — CID 115955982
3-fluoro-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid (PubChem CID 115955982) has the molecular formula C13H13FN2O4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 3-fluoro-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid.
| Compound Name | 3-fluoro-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 115955982 |
| Molecular Formula | C13H13FN2O4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-fluoro-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid |
| SMILES | CCCc1noc(COc2c(F)cccc2C(=O)O)n1 |
| InChI | InChI=1S/C13H13FN2O4/c1-2-4-10-15-11(20-16-10)7-19-12-8(13(17)18)5-3-6-9(12)14/h3,5-6H,2,4,7H2,1H3,(H,17,18) |
| InChIKey | JZFWMACMOPCBFM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |