C12H13FN2O2 — CID 60731170
5-[(2-fluorophenoxy)methyl]-3-propyl-1,2,4-oxadiazole (PubChem CID 60731170) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 5-[(2-fluorophenoxy)methyl]-3-propyl-1,2,4-oxadiazole.
| Compound Name | 5-[(2-fluorophenoxy)methyl]-3-propyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 60731170 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 5-[(2-fluorophenoxy)methyl]-3-propyl-1,2,4-oxadiazole |
| SMILES | CCCc1noc(COc2ccccc2F)n1 |
| InChI | InChI=1S/C12H13FN2O2/c1-2-5-11-14-12(17-15-11)8-16-10-7-4-3-6-9(10)13/h3-4,6-7H,2,5,8H2,1H3 |
| InChIKey | QDXUCTVKUWZGPI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |