C15H17FN2O3 — CID 87011668
(2-fluorophenyl) 4-(3-propyl-1,2,4-oxadiazol-5-yl)butanoate (PubChem CID 87011668) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is (2-fluorophenyl) 4-(3-propyl-1,2,4-oxadiazol-5-yl)butanoate.
| Compound Name | (2-fluorophenyl) 4-(3-propyl-1,2,4-oxadiazol-5-yl)butanoate |
|---|---|
| PubChem CID | 87011668 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (2-fluorophenyl) 4-(3-propyl-1,2,4-oxadiazol-5-yl)butanoate |
| SMILES | CCCc1noc(CCCC(=O)Oc2ccccc2F)n1 |
| InChI | InChI=1S/C15H17FN2O3/c1-2-6-13-17-14(21-18-13)9-5-10-15(19)20-12-8-4-3-7-11(12)16/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | NSCHMIDAOJXMHY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|