C13H13ClN2O3 — CID 61495181
2-chloro-6-[(3-propyl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde (PubChem CID 61495181) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-chloro-6-[(3-propyl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde.
| Compound Name | 2-chloro-6-[(3-propyl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 61495181 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-chloro-6-[(3-propyl-1,2,4-oxadiazol-5-yl)methoxy]benzaldehyde |
| SMILES | CCCc1noc(COc2cccc(Cl)c2C=O)n1 |
| InChI | InChI=1S/C13H13ClN2O3/c1-2-4-12-15-13(19-16-12)8-18-11-6-3-5-10(14)9(11)7-17/h3,5-7H,2,4,8H2,1H3 |
| InChIKey | IHLSXWUGQVXOOV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|