C12H12ClN3O2 — CID 60792234
2-chloro-6-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]benzaldehyde (PubChem CID 60792234) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 2-chloro-6-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]benzaldehyde.
| Compound Name | 2-chloro-6-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 60792234 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-chloro-6-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]benzaldehyde |
| SMILES | Cc1nnc(COc2cccc(Cl)c2C=O)n1C |
| InChI | InChI=1S/C12H12ClN3O2/c1-8-14-15-12(16(8)2)7-18-11-5-3-4-10(13)9(11)6-17/h3-6H,7H2,1-2H3 |
| InChIKey | BVLQNKIQNRTOON-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|