C16H15ClO4 — CID 60790504
2-chloro-6-[(3,4-dimethoxyphenyl)methoxy]benzaldehyde (PubChem CID 60790504) has the molecular formula C16H15ClO4 and a molecular weight of 306.75 g/mol. Its IUPAC name is 2-chloro-6-[(3,4-dimethoxyphenyl)methoxy]benzaldehyde.
| Compound Name | 2-chloro-6-[(3,4-dimethoxyphenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 60790504 |
| Molecular Formula | C16H15ClO4 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-chloro-6-[(3,4-dimethoxyphenyl)methoxy]benzaldehyde |
| SMILES | COc1ccc(COc2cccc(Cl)c2C=O)cc1OC |
| InChI | InChI=1S/C16H15ClO4/c1-19-15-7-6-11(8-16(15)20-2)10-21-14-5-3-4-13(17)12(14)9-18/h3-9H,10H2,1-2H3 |
| InChIKey | CYMDHMROLLLLGI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|