C18H19ClO2 — CID 87530656
2-chloro-6-[(2,5-diethylphenoxy)methyl]benzaldehyde (PubChem CID 87530656) has the molecular formula C18H19ClO2 and a molecular weight of 302.80 g/mol. Its IUPAC name is 2-chloro-6-[(2,5-diethylphenoxy)methyl]benzaldehyde.
| Compound Name | 2-chloro-6-[(2,5-diethylphenoxy)methyl]benzaldehyde |
|---|---|
| PubChem CID | 87530656 |
| Molecular Formula | C18H19ClO2 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-chloro-6-[(2,5-diethylphenoxy)methyl]benzaldehyde |
| SMILES | CCc1ccc(CC)c(OCc2cccc(Cl)c2C=O)c1 |
| InChI | InChI=1S/C18H19ClO2/c1-3-13-8-9-14(4-2)18(10-13)21-12-15-6-5-7-17(19)16(15)11-20/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | YKRAOTWBIGWLGO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|