C9H10Cl2O — CID 90823593
2,6-dichlorobenzaldehyde;ethane (PubChem CID 90823593) has the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. Its IUPAC name is 2,6-dichlorobenzaldehyde;ethane.
| Compound Name | 2,6-dichlorobenzaldehyde;ethane |
|---|---|
| PubChem CID | 90823593 |
| Molecular Formula | C9H10Cl2O |
| Molecular Weight | 205.08 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 2,6-dichlorobenzaldehyde;ethane |
| SMILES | CC.O=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H4Cl2O.C2H6/c8-6-2-1-3-7(9)5(6)4-10;1-2/h1-4H;1-2H3 |
| InChIKey | FVQJOYUCFYKHPZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.08 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|