About 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde
2,6-dichlorobenzaldehyde;4-methylbenzaldehyde (PubChem CID 19356894) has the molecular formula C15H12Cl2O2
and a molecular weight of 295.17 g/mol. Its IUPAC name is 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde.
Molecular Properties
| Compound Name | 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde |
| PubChem CID | 19356894 |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde |
| SMILES | Cc1ccc(C=O)cc1.O=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H8O.C7H4Cl2O/c1-7-2-4-8(6-9)5-3-7;8-6-2-1-3-7(9)5(6)4-10/h2-6H,1H3;1-4H |
| InChIKey | OKXFMAWKWXLCHR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde?
The IUPAC name of 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde (CID 19356894) is 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde.
What is the SMILES notation for 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde?
The canonical SMILES for 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde is Cc1ccc(C=O)cc1.O=Cc1c(Cl)cccc1Cl.
What is the InChIKey of 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde?
The InChIKey is OKXFMAWKWXLCHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C7H4Cl2O/c1-7-2-4-8(6-9)5-3-7;8-6-2-1-3-7(9)5(6)4-10/h2-6H,1H3;1-4H.
What are the key properties of 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde?
2,6-dichlorobenzaldehyde;4-methylbenzaldehyde has a molecular weight of 295.17 g/mol, XLogP of 4.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichlorobenzaldehyde;4-methylbenzaldehyde is sourced from PubChem (CID 19356894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).