About 2,6-dichlorobenzaldehyde
2,6-dichlorobenzaldehyde (PubChem CID 6737) has the molecular formula C7H4Cl2O
and a molecular weight of 175.01 g/mol. Its IUPAC name is 2,6-dichlorobenzaldehyde.
Molecular Properties
| Compound Name | 2,6-dichlorobenzaldehyde |
| PubChem CID | 6737 |
| Molecular Formula | C7H4Cl2O |
| Molecular Weight | 175.01 g/mol |
| Exact Mass | 173.96 |
| IUPAC Name | 2,6-dichlorobenzaldehyde |
| SMILES | O=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H4Cl2O/c8-6-2-1-3-7(9)5(6)4-10/h1-4H |
| InChIKey | DMIYKWPEFRFTPY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.01 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichlorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichlorobenzaldehyde?
The IUPAC name of 2,6-dichlorobenzaldehyde (CID 6737) is 2,6-dichlorobenzaldehyde.
What is the SMILES notation for 2,6-dichlorobenzaldehyde?
The canonical SMILES for 2,6-dichlorobenzaldehyde is O=Cc1c(Cl)cccc1Cl.
What is the InChIKey of 2,6-dichlorobenzaldehyde?
The InChIKey is DMIYKWPEFRFTPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2O/c8-6-2-1-3-7(9)5(6)4-10/h1-4H.
What are the key properties of 2,6-dichlorobenzaldehyde?
2,6-dichlorobenzaldehyde has a molecular weight of 175.01 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichlorobenzaldehyde is sourced from PubChem (CID 6737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).