C15H11Cl4NO3 — CID 158457081
2,6-dichlorobenzaldehyde;2-(2,6-dichlorophenyl)-2-hydroxyacetamide (PubChem CID 158457081) has the molecular formula C15H11Cl4NO3 and a molecular weight of 395.07 g/mol. Its IUPAC name is 2,6-dichlorobenzaldehyde;2-(2,6-dichlorophenyl)-2-hydroxyacetamide.
| Compound Name | 2,6-dichlorobenzaldehyde;2-(2,6-dichlorophenyl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 158457081 |
| Molecular Formula | C15H11Cl4NO3 |
| Molecular Weight | 395.07 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 2,6-dichlorobenzaldehyde;2-(2,6-dichlorophenyl)-2-hydroxyacetamide |
| SMILES | NC(=O)C(O)c1c(Cl)cccc1Cl.O=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H7Cl2NO2.C7H4Cl2O/c9-4-2-1-3-5(10)6(4)7(12)8(11)13;8-6-2-1-3-7(9)5(6)4-10/h1-3,7,12H,(H2,11,13);1-4H |
| InChIKey | HERZUADFNCIUBK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.07 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|