C9H8Cl2O — CID 86691282
2,6-dichloro-3-ethylbenzaldehyde (PubChem CID 86691282) has the molecular formula C9H8Cl2O and a molecular weight of 203.07 g/mol. Its IUPAC name is 2,6-dichloro-3-ethylbenzaldehyde.
| Compound Name | 2,6-dichloro-3-ethylbenzaldehyde |
|---|---|
| PubChem CID | 86691282 |
| Molecular Formula | C9H8Cl2O |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 2,6-dichloro-3-ethylbenzaldehyde |
| SMILES | CCc1ccc(Cl)c(C=O)c1Cl |
| InChI | InChI=1S/C9H8Cl2O/c1-2-6-3-4-8(10)7(5-12)9(6)11/h3-5H,2H2,1H3 |
| InChIKey | OEKGBBXRGBUJLS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|