C11H8Cl3NO — CID 82269486
2,6,7-trichloro-1-ethylindole-3-carbaldehyde (PubChem CID 82269486) has the molecular formula C11H8Cl3NO and a molecular weight of 276.55 g/mol. Its IUPAC name is 2,6,7-trichloro-1-ethylindole-3-carbaldehyde.
| Compound Name | 2,6,7-trichloro-1-ethylindole-3-carbaldehyde |
|---|---|
| PubChem CID | 82269486 |
| Molecular Formula | C11H8Cl3NO |
| Molecular Weight | 276.55 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | 2,6,7-trichloro-1-ethylindole-3-carbaldehyde |
| SMILES | CCn1c(Cl)c(C=O)c2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C11H8Cl3NO/c1-2-15-10-6(7(5-16)11(15)14)3-4-8(12)9(10)13/h3-5H,2H2,1H3 |
| InChIKey | AKFRTVLEYKBAON-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|