C14H13ClFNO2 — CID 82269262
(E)-3-(2-chloro-1-ethyl-7-fluoroindol-3-yl)-2-methylprop-2-enoic acid (PubChem CID 82269262) has the molecular formula C14H13ClFNO2 and a molecular weight of 281.71 g/mol. Its IUPAC name is (E)-3-(2-chloro-1-ethyl-7-fluoroindol-3-yl)-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-(2-chloro-1-ethyl-7-fluoroindol-3-yl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 82269262 |
| Molecular Formula | C14H13ClFNO2 |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | (E)-3-(2-chloro-1-ethyl-7-fluoroindol-3-yl)-2-methylprop-2-enoic acid |
| SMILES | CCn1c(Cl)c(/C=C(\C)C(=O)O)c2cccc(F)c21 |
| InChI | InChI=1S/C14H13ClFNO2/c1-3-17-12-9(5-4-6-11(12)16)10(13(17)15)7-8(2)14(18)19/h4-7H,3H2,1-2H3,(H,18,19)/b8-7+ |
| InChIKey | LVCRINXMHYWVNM-BQYQJAHWSA-N |
| XLogP | 3.94 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|