C17H20ClNO2 — CID 82269647
(E)-3-[2-chloro-6-methyl-1-(2-methylpropyl)indol-3-yl]-2-methylprop-2-enoic acid (PubChem CID 82269647) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is (E)-3-[2-chloro-6-methyl-1-(2-methylpropyl)indol-3-yl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-6-methyl-1-(2-methylpropyl)indol-3-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 82269647 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (E)-3-[2-chloro-6-methyl-1-(2-methylpropyl)indol-3-yl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1c(Cl)n(CC(C)C)c2cc(C)ccc12)C(=O)O |
| InChI | InChI=1S/C17H20ClNO2/c1-10(2)9-19-15-7-11(3)5-6-13(15)14(16(19)18)8-12(4)17(20)21/h5-8,10H,9H2,1-4H3,(H,20,21)/b12-8+ |
| InChIKey | ROJIAEBXTLVCFL-XYOKQWHBSA-N |
| XLogP | 4.75 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|