C15H15ClFNO2 — CID 82269277
(E)-3-[2-chloro-7-fluoro-1-(2-methylpropyl)indol-3-yl]prop-2-enoic acid (PubChem CID 82269277) has the molecular formula C15H15ClFNO2 and a molecular weight of 295.74 g/mol. Its IUPAC name is (E)-3-[2-chloro-7-fluoro-1-(2-methylpropyl)indol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-7-fluoro-1-(2-methylpropyl)indol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82269277 |
| Molecular Formula | C15H15ClFNO2 |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (E)-3-[2-chloro-7-fluoro-1-(2-methylpropyl)indol-3-yl]prop-2-enoic acid |
| SMILES | CC(C)Cn1c(Cl)c(/C=C/C(=O)O)c2cccc(F)c21 |
| InChI | InChI=1S/C15H15ClFNO2/c1-9(2)8-18-14-10(4-3-5-12(14)17)11(15(18)16)6-7-13(19)20/h3-7,9H,8H2,1-2H3,(H,19,20)/b7-6+ |
| InChIKey | GYTJMFFTRXZDGO-VOTSOKGWSA-N |
| XLogP | 4.19 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|