C18H21ClO — CID 67069193
2-[[2-(chloromethyl)phenyl]methoxy]-1,4-diethylbenzene (PubChem CID 67069193) has the molecular formula C18H21ClO and a molecular weight of 288.82 g/mol. Its IUPAC name is 2-[[2-(chloromethyl)phenyl]methoxy]-1,4-diethylbenzene.
| Compound Name | 2-[[2-(chloromethyl)phenyl]methoxy]-1,4-diethylbenzene |
|---|---|
| PubChem CID | 67069193 |
| Molecular Formula | C18H21ClO |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-[[2-(chloromethyl)phenyl]methoxy]-1,4-diethylbenzene |
| SMILES | CCc1ccc(CC)c(OCc2ccccc2CCl)c1 |
| InChI | InChI=1S/C18H21ClO/c1-3-14-9-10-15(4-2)18(11-14)20-13-17-8-6-5-7-16(17)12-19/h5-11H,3-4,12-13H2,1-2H3 |
| InChIKey | JKYXCEDSNLPGFB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|